C69H72N2O4 — CID 102326993
4-[(E)-2-[9,9-dihexyl-7-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]fluoren-2-yl]ethenyl]-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 102326993) has the molecular formula C69H72N2O4 and a molecular weight of 993.35 g/mol. Its IUPAC name is 4-[(E)-2-[9,9-dihexyl-7-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]fluoren-2-yl]ethenyl]-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 4-[(E)-2-[9,9-dihexyl-7-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]fluoren-2-yl]ethenyl]-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 102326993 |
| Molecular Formula | C69H72N2O4 |
| Molecular Weight | 993.35 g/mol |
| Exact Mass | 992.55 |
| IUPAC Name | 4-[(E)-2-[9,9-dihexyl-7-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]fluoren-2-yl]ethenyl]-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | CCCCCCC1(CCCCCC)c2cc(/C=C/c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)ccc2-c2ccc(/C=C/c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)cc21 |
| InChI | InChI=1S/C69H72N2O4/c1-7-9-11-13-47-69(48-14-12-10-8-2)67-49-53(17-15-51-19-25-55(26-20-51)70(57-29-37-61(72-3)38-30-57)58-31-39-62(73-4)40-32-58)23-45-65(67)66-46-24-54(50-68(66)69)18-16-52-21-27-56(28-22-52)71(59-33-41-63(74-5)42-34-59)60-35-43-64(75-6)44-36-60/h15-46,49-50H,7-14,47-48H2,1-6H3/b17-15+,18-16+ |
| InChIKey | AXQADTNHQHORJT-YTEMWHBBSA-N |
| XLogP | 19.21 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.35 |
| LogP ≤ 5 | 19.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|