C56H76O2 — CID 23594373
2-[(E)-2-[5-(2-ethylhexoxy)-2-methoxy-4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]-7-methyl-9,9-dioctylfluorene (PubChem CID 23594373) has the molecular formula C56H76O2 and a molecular weight of 781.22 g/mol. Its IUPAC name is 2-[(E)-2-[5-(2-ethylhexoxy)-2-methoxy-4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]-7-methyl-9,9-dioctylfluorene.
| Compound Name | 2-[(E)-2-[5-(2-ethylhexoxy)-2-methoxy-4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]-7-methyl-9,9-dioctylfluorene |
|---|---|
| PubChem CID | 23594373 |
| Molecular Formula | C56H76O2 |
| Molecular Weight | 781.22 g/mol |
| Exact Mass | 780.58 |
| IUPAC Name | 2-[(E)-2-[5-(2-ethylhexoxy)-2-methoxy-4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]-7-methyl-9,9-dioctylfluorene |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(/C=C/c3cc(OCC(CC)CCCC)c(/C=C/c4ccc(C)cc4)cc3OC)cc21 |
| InChI | InChI=1S/C56H76O2/c1-8-12-15-17-19-21-36-56(37-22-20-18-16-13-9-2)52-38-44(6)26-34-50(52)51-35-31-47(39-53(51)56)30-33-48-41-55(58-42-45(11-4)23-14-10-3)49(40-54(48)57-7)32-29-46-27-24-43(5)25-28-46/h24-35,38-41,45H,8-23,36-37,42H2,1-7H3/b32-29+,33-30+ |
| InChIKey | DKKBTHUCPCDWQF-AMUWBTNVSA-N |
| XLogP | 17.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.22 |
| LogP ≤ 5 | 17.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|