C50H72O2 — CID 89086695
2-[(E)-2-[5-(2-ethylhexoxy)-2-methoxy-4-[(E)-prop-1-enyl]phenyl]ethenyl]-7-methyl-9,9-dioctylfluorene (PubChem CID 89086695) has the molecular formula C50H72O2 and a molecular weight of 705.12 g/mol. Its IUPAC name is 2-[(E)-2-[5-(2-ethylhexoxy)-2-methoxy-4-[(E)-prop-1-enyl]phenyl]ethenyl]-7-methyl-9,9-dioctylfluorene.
| Compound Name | 2-[(E)-2-[5-(2-ethylhexoxy)-2-methoxy-4-[(E)-prop-1-enyl]phenyl]ethenyl]-7-methyl-9,9-dioctylfluorene |
|---|---|
| PubChem CID | 89086695 |
| Molecular Formula | C50H72O2 |
| Molecular Weight | 705.12 g/mol |
| Exact Mass | 704.55 |
| IUPAC Name | 2-[(E)-2-[5-(2-ethylhexoxy)-2-methoxy-4-[(E)-prop-1-enyl]phenyl]ethenyl]-7-methyl-9,9-dioctylfluorene |
| SMILES | C/C=C/c1cc(OC)c(/C=C/c2ccc3c(c2)C(CCCCCCCC)(CCCCCCCC)c2cc(C)ccc2-3)cc1OCC(CC)CCCC |
| InChI | InChI=1S/C50H72O2/c1-8-13-16-18-20-22-32-50(33-23-21-19-17-14-9-2)46-34-39(6)26-30-44(46)45-31-28-41(35-47(45)50)27-29-43-37-49(42(24-11-4)36-48(43)51-7)52-38-40(12-5)25-15-10-3/h11,24,26-31,34-37,40H,8-10,12-23,25,32-33,38H2,1-7H3/b24-11+,29-27+ |
| InChIKey | JYVUBAFIUGAEGO-OJEFAINQSA-N |
| XLogP | 15.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.12 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|