C38H49BrO2 — CID 135816764
1-[(E)-2-(4-bromophenyl)ethenyl]-5-[(2S)-2-ethylhexoxy]-2-[(2R)-2-ethylhexoxy]-4-[(E)-2-phenylethenyl]benzene (PubChem CID 135816764) has the molecular formula C38H49BrO2 and a molecular weight of 617.71 g/mol. Its IUPAC name is 1-[(E)-2-(4-bromophenyl)ethenyl]-5-[(2S)-2-ethylhexoxy]-2-[(2R)-2-ethylhexoxy]-4-[(E)-2-phenylethenyl]benzene.
| Compound Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-5-[(2S)-2-ethylhexoxy]-2-[(2R)-2-ethylhexoxy]-4-[(E)-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 135816764 |
| Molecular Formula | C38H49BrO2 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-5-[(2S)-2-ethylhexoxy]-2-[(2R)-2-ethylhexoxy]-4-[(E)-2-phenylethenyl]benzene |
| SMILES | CCCC[C@@H](CC)COc1cc(/C=C/c2ccccc2)c(OC[C@@H](CC)CCCC)cc1/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C38H49BrO2/c1-5-9-14-30(7-3)28-40-37-27-35(23-19-33-20-24-36(39)25-21-33)38(41-29-31(8-4)15-10-6-2)26-34(37)22-18-32-16-12-11-13-17-32/h11-13,16-27,30-31H,5-10,14-15,28-29H2,1-4H3/b22-18+,23-19+/t30-,31+/m0/s1 |
| InChIKey | HJBSQRPHDORCQR-ARCGTKJOSA-N |
| XLogP | 11.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|