C62H64Br4N2O2 — CID 59629901
4-[(E)-2-[4-[(E)-2-[4-(4-bromo-N-(4-bromophenyl)anilino)phenyl]ethenyl]-2,5-bis(2-ethylhexoxy)phenyl]ethenyl]-N,N-bis(4-bromophenyl)aniline (PubChem CID 59629901) has the molecular formula C62H64Br4N2O2 and a molecular weight of 1188.82 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-[4-(4-bromo-N-(4-bromophenyl)anilino)phenyl]ethenyl]-2,5-bis(2-ethylhexoxy)phenyl]ethenyl]-N,N-bis(4-bromophenyl)aniline.
| Compound Name | 4-[(E)-2-[4-[(E)-2-[4-(4-bromo-N-(4-bromophenyl)anilino)phenyl]ethenyl]-2,5-bis(2-ethylhexoxy)phenyl]ethenyl]-N,N-bis(4-bromophenyl)aniline |
|---|---|
| PubChem CID | 59629901 |
| Molecular Formula | C62H64Br4N2O2 |
| Molecular Weight | 1188.82 g/mol |
| Exact Mass | 1184.17 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-[4-(4-bromo-N-(4-bromophenyl)anilino)phenyl]ethenyl]-2,5-bis(2-ethylhexoxy)phenyl]ethenyl]-N,N-bis(4-bromophenyl)aniline |
| SMILES | CCCCC(CC)COc1cc(/C=C/c2ccc(N(c3ccc(Br)cc3)c3ccc(Br)cc3)cc2)c(OCC(CC)CCCC)cc1/C=C/c1ccc(N(c2ccc(Br)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C62H64Br4N2O2/c1-5-9-11-45(7-3)43-69-61-41-50(20-14-48-17-31-56(32-18-48)68(59-37-25-53(65)26-38-59)60-39-27-54(66)28-40-60)62(70-44-46(8-4)12-10-6-2)42-49(61)19-13-47-15-29-55(30-16-47)67(57-33-21-51(63)22-34-57)58-35-23-52(64)24-36-58/h13-42,45-46H,5-12,43-44H2,1-4H3/b19-13+,20-14+ |
| InChIKey | QRAKZJBNKCIXEG-IWGRKNQJSA-N |
| XLogP | 21.21 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1188.82 |
| LogP ≤ 5 | 21.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|