C28H30Br2OS — CID 101392914
2,5-dibromo-3-[(E)-2-[4-[(E)-2-[4-(2-ethylhexoxy)phenyl]ethenyl]phenyl]ethenyl]thiophene (PubChem CID 101392914) has the molecular formula C28H30Br2OS and a molecular weight of 574.42 g/mol. Its IUPAC name is 2,5-dibromo-3-[(E)-2-[4-[(E)-2-[4-(2-ethylhexoxy)phenyl]ethenyl]phenyl]ethenyl]thiophene.
| Compound Name | 2,5-dibromo-3-[(E)-2-[4-[(E)-2-[4-(2-ethylhexoxy)phenyl]ethenyl]phenyl]ethenyl]thiophene |
|---|---|
| PubChem CID | 101392914 |
| Molecular Formula | C28H30Br2OS |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | 2,5-dibromo-3-[(E)-2-[4-[(E)-2-[4-(2-ethylhexoxy)phenyl]ethenyl]phenyl]ethenyl]thiophene |
| SMILES | CCCCC(CC)COc1ccc(/C=C/c2ccc(/C=C/c3cc(Br)sc3Br)cc2)cc1 |
| InChI | InChI=1S/C28H30Br2OS/c1-3-5-6-21(4-2)20-31-26-17-14-24(15-18-26)12-9-22-7-10-23(11-8-22)13-16-25-19-27(29)32-28(25)30/h7-19,21H,3-6,20H2,1-2H3/b12-9+,16-13+ |
| InChIKey | MGSKHRFTAWAORW-USJAFLQSSA-N |
| XLogP | 10.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|