C40H49Br2NO2S — CID 101479951
4-[(E)-2-(2,5-dibromothiophen-3-yl)ethenyl]-N,N-bis(4-octoxyphenyl)aniline (PubChem CID 101479951) has the molecular formula C40H49Br2NO2S and a molecular weight of 767.71 g/mol. Its IUPAC name is 4-[(E)-2-(2,5-dibromothiophen-3-yl)ethenyl]-N,N-bis(4-octoxyphenyl)aniline.
| Compound Name | 4-[(E)-2-(2,5-dibromothiophen-3-yl)ethenyl]-N,N-bis(4-octoxyphenyl)aniline |
|---|---|
| PubChem CID | 101479951 |
| Molecular Formula | C40H49Br2NO2S |
| Molecular Weight | 767.71 g/mol |
| Exact Mass | 765.19 |
| IUPAC Name | 4-[(E)-2-(2,5-dibromothiophen-3-yl)ethenyl]-N,N-bis(4-octoxyphenyl)aniline |
| SMILES | CCCCCCCCOc1ccc(N(c2ccc(/C=C/c3cc(Br)sc3Br)cc2)c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C40H49Br2NO2S/c1-3-5-7-9-11-13-29-44-37-25-21-35(22-26-37)43(36-23-27-38(28-24-36)45-30-14-12-10-8-6-4-2)34-19-16-32(17-20-34)15-18-33-31-39(41)46-40(33)42/h15-28,31H,3-14,29-30H2,1-2H3/b18-15+ |
| InChIKey | QNGRYKOCIKHNRS-OBGWFSINSA-N |
| XLogP | 14.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.71 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|