C21H26Br2O2S — CID 141141447
2,5-dibromo-3-[2-(3-methoxy-4-octoxyphenyl)ethenyl]thiophene (PubChem CID 141141447) has the molecular formula C21H26Br2O2S and a molecular weight of 502.31 g/mol. Its IUPAC name is 2,5-dibromo-3-[2-(3-methoxy-4-octoxyphenyl)ethenyl]thiophene.
| Compound Name | 2,5-dibromo-3-[2-(3-methoxy-4-octoxyphenyl)ethenyl]thiophene |
|---|---|
| PubChem CID | 141141447 |
| Molecular Formula | C21H26Br2O2S |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | 2,5-dibromo-3-[2-(3-methoxy-4-octoxyphenyl)ethenyl]thiophene |
| SMILES | CCCCCCCCOc1ccc(C=Cc2cc(Br)sc2Br)cc1OC |
| InChI | InChI=1S/C21H26Br2O2S/c1-3-4-5-6-7-8-13-25-18-12-10-16(14-19(18)24-2)9-11-17-15-20(22)26-21(17)23/h9-12,14-15H,3-8,13H2,1-2H3 |
| InChIKey | HHVIQGNMGWGZIM-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|