C62H68N2O2 — CID 101129124
N-[4-[(E)-2-[2,5-dihexoxy-4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 101129124) has the molecular formula C62H68N2O2 and a molecular weight of 873.24 g/mol. Its IUPAC name is N-[4-[(E)-2-[2,5-dihexoxy-4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[(E)-2-[2,5-dihexoxy-4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 101129124 |
| Molecular Formula | C62H68N2O2 |
| Molecular Weight | 873.24 g/mol |
| Exact Mass | 872.53 |
| IUPAC Name | N-[4-[(E)-2-[2,5-dihexoxy-4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | CCCCCCOc1cc(/C=C/c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c(OCCCCCC)cc1/C=C/c1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C62H68N2O2/c1-7-9-11-13-43-65-61-45-54(30-24-52-27-41-60(42-28-52)64(57-35-19-49(5)20-36-57)58-37-21-50(6)22-38-58)62(66-44-14-12-10-8-2)46-53(61)29-23-51-25-39-59(40-26-51)63(55-31-15-47(3)16-32-55)56-33-17-48(4)18-34-56/h15-42,45-46H,7-14,43-44H2,1-6H3/b29-23+,30-24+ |
| InChIKey | PEKCQWGOCDVKDC-HCTXVGCHSA-N |
| XLogP | 18.12 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.24 |
| LogP ≤ 5 | 18.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|