C42H43NO2 — CID 54368987
N-[4-[2-(4-methyl-2,5-dipropoxyphenyl)ethenyl]phenyl]-N-(4-phenylphenyl)-4-prop-1-enylaniline (PubChem CID 54368987) has the molecular formula C42H43NO2 and a molecular weight of 593.81 g/mol. Its IUPAC name is N-[4-[2-(4-methyl-2,5-dipropoxyphenyl)ethenyl]phenyl]-N-(4-phenylphenyl)-4-prop-1-enylaniline.
| Compound Name | N-[4-[2-(4-methyl-2,5-dipropoxyphenyl)ethenyl]phenyl]-N-(4-phenylphenyl)-4-prop-1-enylaniline |
|---|---|
| PubChem CID | 54368987 |
| Molecular Formula | C42H43NO2 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | N-[4-[2-(4-methyl-2,5-dipropoxyphenyl)ethenyl]phenyl]-N-(4-phenylphenyl)-4-prop-1-enylaniline |
| SMILES | CC=Cc1ccc(N(c2ccc(C=Cc3cc(OCCC)c(C)cc3OCCC)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C42H43NO2/c1-5-11-33-15-22-38(23-16-33)43(40-26-20-36(21-27-40)35-12-9-8-10-13-35)39-24-17-34(18-25-39)14-19-37-31-41(44-28-6-2)32(4)30-42(37)45-29-7-3/h5,8-27,30-31H,6-7,28-29H2,1-4H3 |
| InChIKey | URUJSYMMMSAOOU-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|