C34H46BrNO2 — CID 98047352
N-(4-bromophenyl)-4-[(2R)-2-ethylhexoxy]-N-[4-[(2R)-2-ethylhexoxy]phenyl]aniline (PubChem CID 98047352) has the molecular formula C34H46BrNO2 and a molecular weight of 580.65 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[(2R)-2-ethylhexoxy]-N-[4-[(2R)-2-ethylhexoxy]phenyl]aniline.
| Compound Name | N-(4-bromophenyl)-4-[(2R)-2-ethylhexoxy]-N-[4-[(2R)-2-ethylhexoxy]phenyl]aniline |
|---|---|
| PubChem CID | 98047352 |
| Molecular Formula | C34H46BrNO2 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | N-(4-bromophenyl)-4-[(2R)-2-ethylhexoxy]-N-[4-[(2R)-2-ethylhexoxy]phenyl]aniline |
| SMILES | CCCC[C@@H](CC)COc1ccc(N(c2ccc(Br)cc2)c2ccc(OC[C@H](CC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C34H46BrNO2/c1-5-9-11-27(7-3)25-37-33-21-17-31(18-22-33)36(30-15-13-29(35)14-16-30)32-19-23-34(24-20-32)38-26-28(8-4)12-10-6-2/h13-24,27-28H,5-12,25-26H2,1-4H3/t27-,28-/m1/s1 |
| InChIKey | IBNDUCBIJXFUIS-VSGBNLITSA-N |
| XLogP | 11.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |