C38H46BrNO2 — CID 145157801
4-bromo-2,6-bis[2-[4-(2-ethylhexoxy)phenyl]ethynyl]aniline (PubChem CID 145157801) has the molecular formula C38H46BrNO2 and a molecular weight of 628.70 g/mol. Its IUPAC name is 4-bromo-2,6-bis[2-[4-(2-ethylhexoxy)phenyl]ethynyl]aniline.
| Compound Name | 4-bromo-2,6-bis[2-[4-(2-ethylhexoxy)phenyl]ethynyl]aniline |
|---|---|
| PubChem CID | 145157801 |
| Molecular Formula | C38H46BrNO2 |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | 4-bromo-2,6-bis[2-[4-(2-ethylhexoxy)phenyl]ethynyl]aniline |
| SMILES | CCCCC(CC)COc1ccc(C#Cc2cc(Br)cc(C#Cc3ccc(OCC(CC)CCCC)cc3)c2N)cc1 |
| InChI | InChI=1S/C38H46BrNO2/c1-5-9-11-29(7-3)27-41-36-21-15-31(16-22-36)13-19-33-25-35(39)26-34(38(33)40)20-14-32-17-23-37(24-18-32)42-28-30(8-4)12-10-6-2/h15-18,21-26,29-30H,5-12,27-28,40H2,1-4H3 |
| InChIKey | AEOLSTQJJJNKSW-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|