C52H62O4 — CID 101390382
1,4-bis(2-ethylhexoxy)-2,5-bis[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzene (PubChem CID 101390382) has the molecular formula C52H62O4 and a molecular weight of 751.06 g/mol. Its IUPAC name is 1,4-bis(2-ethylhexoxy)-2,5-bis[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzene.
| Compound Name | 1,4-bis(2-ethylhexoxy)-2,5-bis[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 101390382 |
| Molecular Formula | C52H62O4 |
| Molecular Weight | 751.06 g/mol |
| Exact Mass | 750.46 |
| IUPAC Name | 1,4-bis(2-ethylhexoxy)-2,5-bis[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzene |
| SMILES | CCCCC(CC)COc1cc(/C=C/c2ccc(OCc3ccccc3)cc2)c(OCC(CC)CCCC)cc1/C=C/c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C52H62O4/c1-5-9-17-41(7-3)37-55-51-35-48(30-24-44-27-33-50(34-28-44)54-40-46-21-15-12-16-22-46)52(56-38-42(8-4)18-10-6-2)36-47(51)29-23-43-25-31-49(32-26-43)53-39-45-19-13-11-14-20-45/h11-16,19-36,41-42H,5-10,17-18,37-40H2,1-4H3/b29-23+,30-24+ |
| InChIKey | CGYKHWDQFGLJRI-HCTXVGCHSA-N |
| XLogP | 14.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.06 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|