C31H42N2O4 — CID 123871999
1,4-bis(2-ethylhexoxy)-2-[(E)-2-(4-isocyanophenyl)ethenyl]-5-nitrobenzene (PubChem CID 123871999) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is 1,4-bis(2-ethylhexoxy)-2-[(E)-2-(4-isocyanophenyl)ethenyl]-5-nitrobenzene.
| Compound Name | 1,4-bis(2-ethylhexoxy)-2-[(E)-2-(4-isocyanophenyl)ethenyl]-5-nitrobenzene |
|---|---|
| PubChem CID | 123871999 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 1,4-bis(2-ethylhexoxy)-2-[(E)-2-(4-isocyanophenyl)ethenyl]-5-nitrobenzene |
| SMILES | [C-]#[N+]c1ccc(/C=C/c2cc(OCC(CC)CCCC)c([N+](=O)[O-])cc2OCC(CC)CCCC)cc1 |
| InChI | InChI=1S/C31H42N2O4/c1-6-10-12-24(8-3)22-36-30-21-29(33(34)35)31(37-23-25(9-4)13-11-7-2)20-27(30)17-14-26-15-18-28(32-5)19-16-26/h14-21,24-25H,6-13,22-23H2,1-4H3/b17-14+ |
| InChIKey | QJGDTAXFOVXQIW-SAPNQHFASA-N |
| XLogP | 9.51 |
| TPSA | 65.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|