C45H57NO2 — CID 143348020
4-[(E)-2-[2,5-bis(2-ethylhexoxy)-4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]-N-phenylaniline (PubChem CID 143348020) has the molecular formula C45H57NO2 and a molecular weight of 643.96 g/mol. Its IUPAC name is 4-[(E)-2-[2,5-bis(2-ethylhexoxy)-4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]-N-phenylaniline.
| Compound Name | 4-[(E)-2-[2,5-bis(2-ethylhexoxy)-4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 143348020 |
| Molecular Formula | C45H57NO2 |
| Molecular Weight | 643.96 g/mol |
| Exact Mass | 643.44 |
| IUPAC Name | 4-[(E)-2-[2,5-bis(2-ethylhexoxy)-4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]-N-phenylaniline |
| SMILES | CCCCC(CC)COc1cc(/C=C/c2ccc(Nc3ccccc3)cc2)c(OCC(CC)CCCC)cc1/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C45H57NO2/c1-6-10-15-36(8-3)33-47-44-32-41(28-24-39-25-29-43(30-26-39)46-42-17-13-12-14-18-42)45(48-34-37(9-4)16-11-7-2)31-40(44)27-23-38-21-19-35(5)20-22-38/h12-14,17-32,36-37,46H,6-11,15-16,33-34H2,1-5H3/b27-23+,28-24+ |
| InChIKey | MQZQPQXGWGBGPB-LMCGJEQXSA-N |
| XLogP | 13.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.96 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|