C51H61NO2 — CID 72604608
2,5-bis[2-[3-(2-ethylhexoxy)phenyl]ethenyl]-6-methyl-3-[4-(4-methylphenyl)phenyl]pyridine (PubChem CID 72604608) has the molecular formula C51H61NO2 and a molecular weight of 720.05 g/mol. Its IUPAC name is 2,5-bis[2-[3-(2-ethylhexoxy)phenyl]ethenyl]-6-methyl-3-[4-(4-methylphenyl)phenyl]pyridine.
| Compound Name | 2,5-bis[2-[3-(2-ethylhexoxy)phenyl]ethenyl]-6-methyl-3-[4-(4-methylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 72604608 |
| Molecular Formula | C51H61NO2 |
| Molecular Weight | 720.05 g/mol |
| Exact Mass | 719.47 |
| IUPAC Name | 2,5-bis[2-[3-(2-ethylhexoxy)phenyl]ethenyl]-6-methyl-3-[4-(4-methylphenyl)phenyl]pyridine |
| SMILES | CCCCC(CC)COc1cccc(C=Cc2cc(-c3ccc(-c4ccc(C)cc4)cc3)c(C=Cc3cccc(OCC(CC)CCCC)c3)nc2C)c1 |
| InChI | InChI=1S/C51H61NO2/c1-7-11-15-40(9-3)36-53-48-19-13-17-42(33-48)23-27-47-35-50(46-30-28-45(29-31-46)44-25-21-38(5)22-26-44)51(52-39(47)6)32-24-43-18-14-20-49(34-43)54-37-41(10-4)16-12-8-2/h13-14,17-35,40-41H,7-12,15-16,36-37H2,1-6H3 |
| InChIKey | VSRVSVBJUYJSLC-UHFFFAOYSA-N |
| XLogP | 14.56 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.05 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |