C32H34N2O3 — CID 11627372
6-[(E)-2-[4-[(E)-2-[4-(2-ethylhexoxy)phenyl]ethenyl]phenyl]ethenyl]-2,3-dihydrophthalazine-1,4-dione (PubChem CID 11627372) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 6-[(E)-2-[4-[(E)-2-[4-(2-ethylhexoxy)phenyl]ethenyl]phenyl]ethenyl]-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 6-[(E)-2-[4-[(E)-2-[4-(2-ethylhexoxy)phenyl]ethenyl]phenyl]ethenyl]-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 11627372 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 6-[(E)-2-[4-[(E)-2-[4-(2-ethylhexoxy)phenyl]ethenyl]phenyl]ethenyl]-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CCCCC(CC)COc1ccc(/C=C/c2ccc(/C=C/c3ccc4c(=O)[nH][nH]c(=O)c4c3)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-3-5-6-23(4-2)22-37-28-18-15-26(16-19-28)12-11-24-7-9-25(10-8-24)13-14-27-17-20-29-30(21-27)32(36)34-33-31(29)35/h7-21,23H,3-6,22H2,1-2H3,(H,33,35)(H,34,36)/b12-11+,14-13+ |
| InChIKey | PYLJHUXLNHVOOR-LDHFCIDVSA-N |
| XLogP | 7.15 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|