C64H84O4 — CID 58720454
2-[3-[2-[2-(2-ethylhexoxy)-5-methoxy-4-[2-(3-methoxy-5-methylphenyl)ethenyl]phenyl]ethenyl]-5-methoxyphenyl]-7-methyl-9,9-dioctylfluorene (PubChem CID 58720454) has the molecular formula C64H84O4 and a molecular weight of 917.37 g/mol. Its IUPAC name is 2-[3-[2-[2-(2-ethylhexoxy)-5-methoxy-4-[2-(3-methoxy-5-methylphenyl)ethenyl]phenyl]ethenyl]-5-methoxyphenyl]-7-methyl-9,9-dioctylfluorene.
| Compound Name | 2-[3-[2-[2-(2-ethylhexoxy)-5-methoxy-4-[2-(3-methoxy-5-methylphenyl)ethenyl]phenyl]ethenyl]-5-methoxyphenyl]-7-methyl-9,9-dioctylfluorene |
|---|---|
| PubChem CID | 58720454 |
| Molecular Formula | C64H84O4 |
| Molecular Weight | 917.37 g/mol |
| Exact Mass | 916.64 |
| IUPAC Name | 2-[3-[2-[2-(2-ethylhexoxy)-5-methoxy-4-[2-(3-methoxy-5-methylphenyl)ethenyl]phenyl]ethenyl]-5-methoxyphenyl]-7-methyl-9,9-dioctylfluorene |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3cc(C=Cc4cc(OC)c(C=Cc5cc(C)cc(OC)c5)cc4OCC(CC)CCCC)cc(OC)c3)cc21 |
| InChI | InChI=1S/C64H84O4/c1-10-14-17-19-21-23-34-64(35-24-22-20-18-15-11-2)60-38-47(5)26-32-58(60)59-33-31-52(43-61(59)64)55-39-51(41-57(42-55)66-8)28-30-54-44-62(67-9)53(29-27-50-36-48(6)37-56(40-50)65-7)45-63(54)68-46-49(13-4)25-16-12-3/h26-33,36-45,49H,10-25,34-35,46H2,1-9H3 |
| InChIKey | PKBPUCCDHJFLSZ-UHFFFAOYSA-N |
| XLogP | 18.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.37 |
| LogP ≤ 5 | 18.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|