C67H84O — CID 159440887
2-[4-[(E)-2-[5-(2-ethylhexoxy)-2,4-dimethylphenyl]ethenyl]phenyl]-9,9-dioctyl-7-[4-[(E)-prop-1-enyl]phenyl]fluorene;penta-1,3-diyne (PubChem CID 159440887) has the molecular formula C67H84O and a molecular weight of 905.41 g/mol. Its IUPAC name is 2-[4-[(E)-2-[5-(2-ethylhexoxy)-2,4-dimethylphenyl]ethenyl]phenyl]-9,9-dioctyl-7-[4-[(E)-prop-1-enyl]phenyl]fluorene;penta-1,3-diyne.
| Compound Name | 2-[4-[(E)-2-[5-(2-ethylhexoxy)-2,4-dimethylphenyl]ethenyl]phenyl]-9,9-dioctyl-7-[4-[(E)-prop-1-enyl]phenyl]fluorene;penta-1,3-diyne |
|---|---|
| PubChem CID | 159440887 |
| Molecular Formula | C67H84O |
| Molecular Weight | 905.41 g/mol |
| Exact Mass | 904.65 |
| IUPAC Name | 2-[4-[(E)-2-[5-(2-ethylhexoxy)-2,4-dimethylphenyl]ethenyl]phenyl]-9,9-dioctyl-7-[4-[(E)-prop-1-enyl]phenyl]fluorene;penta-1,3-diyne |
| SMILES | C#CC#CC.C/C=C/c1ccc(-c2ccc3c(c2)C(CCCCCCCC)(CCCCCCCC)c2cc(-c4ccc(/C=C/c5cc(OCC(CC)CCCC)c(C)cc5C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C62H80O.C5H4/c1-8-13-16-18-20-22-40-62(41-23-21-19-17-14-9-2)59-43-55(52-31-26-50(24-11-4)27-32-52)36-38-57(59)58-39-37-56(44-60(58)62)53-33-28-51(29-34-53)30-35-54-45-61(48(7)42-47(54)6)63-46-49(12-5)25-15-10-3;1-3-5-4-2/h11,24,26-39,42-45,49H,8-10,12-23,25,40-41,46H2,1-7H3;1H,2H3/b24-11+,35-30+; |
| InChIKey | TVLLRWFTGWZQCW-YKXGOSRUSA-N |
| XLogP | 19.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.41 |
| LogP ≤ 5 | 19.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|