C54H68O2 — CID 58012931
2-[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]-7-methyl-9,9-dipropylfluorene (PubChem CID 58012931) has the molecular formula C54H68O2 and a molecular weight of 749.14 g/mol. Its IUPAC name is 2-[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]-7-methyl-9,9-dipropylfluorene.
| Compound Name | 2-[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]-7-methyl-9,9-dipropylfluorene |
|---|---|
| PubChem CID | 58012931 |
| Molecular Formula | C54H68O2 |
| Molecular Weight | 749.14 g/mol |
| Exact Mass | 748.52 |
| IUPAC Name | 2-[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]-7-methyl-9,9-dipropylfluorene |
| SMILES | CCCCC(CC)COc1ccc(-c2cc(-c3ccc(OCC(CC)CCCC)cc3)cc(-c3ccc4c(c3)C(CCC)(CCC)c3cc(C)ccc3-4)c2)cc1 |
| InChI | InChI=1S/C54H68O2/c1-8-14-16-40(12-5)37-55-48-24-19-42(20-25-48)45-33-46(43-21-26-49(27-22-43)56-38-41(13-6)17-15-9-2)35-47(34-45)44-23-29-51-50-28-18-39(7)32-52(50)54(30-10-3,31-11-4)53(51)36-44/h18-29,32-36,40-41H,8-17,30-31,37-38H2,1-7H3 |
| InChIKey | PTUAVHVULLNLJY-UHFFFAOYSA-N |
| XLogP | 16.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.14 |
| LogP ≤ 5 | 16.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |