C44H52O — CID 20751967
2-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-7-methylfluoren-9-one (PubChem CID 20751967) has the molecular formula C44H52O and a molecular weight of 596.90 g/mol. Its IUPAC name is 2-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-7-methylfluoren-9-one.
| Compound Name | 2-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-7-methylfluoren-9-one |
|---|---|
| PubChem CID | 20751967 |
| Molecular Formula | C44H52O |
| Molecular Weight | 596.90 g/mol |
| Exact Mass | 596.40 |
| IUPAC Name | 2-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-7-methylfluoren-9-one |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2cc(C)ccc2-c2ccc(-c3ccc4c(c3)C(=O)c3cc(C)ccc3-4)cc21 |
| InChI | InChI=1S/C44H52O/c1-7-11-13-31(9-3)27-44(28-32(10-4)14-12-8-2)41-24-30(6)16-20-37(41)38-22-18-34(26-42(38)44)33-17-21-36-35-19-15-29(5)23-39(35)43(45)40(36)25-33/h15-26,31-32H,7-14,27-28H2,1-6H3 |
| InChIKey | RMMFOKQOVYLQAA-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.90 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |