C37H48N2S — CID 90352299
4-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-7-methyl-2,1,3-benzothiadiazole (PubChem CID 90352299) has the molecular formula C37H48N2S and a molecular weight of 552.87 g/mol. Its IUPAC name is 4-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-7-methyl-2,1,3-benzothiadiazole.
| Compound Name | 4-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-7-methyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 90352299 |
| Molecular Formula | C37H48N2S |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 4-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-7-methyl-2,1,3-benzothiadiazole |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2cc(C)ccc2-c2ccc(-c3ccc(C)c4nsnc34)cc21 |
| InChI | InChI=1S/C37H48N2S/c1-7-11-13-27(9-3)23-37(24-28(10-4)14-12-8-2)33-21-25(5)15-18-31(33)32-20-17-29(22-34(32)37)30-19-16-26(6)35-36(30)39-40-38-35/h15-22,27-28H,7-14,23-24H2,1-6H3 |
| InChIKey | AIPVSFRLXJPQII-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |