C52H60N2S — CID 167359455
4,7-bis[7-(2-ethylhexyl)-9,9-dimethylfluoren-2-yl]-2,1,3-benzothiadiazole (PubChem CID 167359455) has the molecular formula C52H60N2S and a molecular weight of 745.13 g/mol. Its IUPAC name is 4,7-bis[7-(2-ethylhexyl)-9,9-dimethylfluoren-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[7-(2-ethylhexyl)-9,9-dimethylfluoren-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 167359455 |
| Molecular Formula | C52H60N2S |
| Molecular Weight | 745.13 g/mol |
| Exact Mass | 744.45 |
| IUPAC Name | 4,7-bis[7-(2-ethylhexyl)-9,9-dimethylfluoren-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCCC(CC)Cc1ccc2c(c1)C(C)(C)c1cc(-c3ccc(-c4ccc5c(c4)C(C)(C)c4cc(CC(CC)CCCC)ccc4-5)c4nsnc34)ccc1-2 |
| InChI | InChI=1S/C52H60N2S/c1-9-13-15-33(11-3)27-35-17-21-41-43-23-19-37(31-47(43)51(5,6)45(41)29-35)39-25-26-40(50-49(39)53-55-54-50)38-20-24-44-42-22-18-36(28-34(12-4)16-14-10-2)30-46(42)52(7,8)48(44)32-38/h17-26,29-34H,9-16,27-28H2,1-8H3 |
| InChIKey | RBIVIBNCZWAGTP-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.13 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |