C17H26O — CID 175505048
2-(2-ethylhexyl)bicyclo[2.2.0]hexa-1,3,5-triene;methoxyethene (PubChem CID 175505048) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-(2-ethylhexyl)bicyclo[2.2.0]hexa-1,3,5-triene;methoxyethene.
| Compound Name | 2-(2-ethylhexyl)bicyclo[2.2.0]hexa-1,3,5-triene;methoxyethene |
|---|---|
| PubChem CID | 175505048 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-(2-ethylhexyl)bicyclo[2.2.0]hexa-1,3,5-triene;methoxyethene |
| SMILES | C=COC.CCCCC(CC)Cc1cc2ccc1-2 |
| InChI | InChI=1S/C14H20.C3H6O/c1-3-5-6-11(4-2)9-13-10-12-7-8-14(12)13;1-3-4-2/h7-8,10-11H,3-6,9H2,1-2H3;3H,1H2,2H3 |
| InChIKey | BWHPVXJWIXBNMQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|