C90H126 — CID 131637875
1,2,3,4,5,6-hexakis[4-(2-ethylhexyl)phenyl]benzene (PubChem CID 131637875) has the molecular formula C90H126 and a molecular weight of 1208.00 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis[4-(2-ethylhexyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5,6-hexakis[4-(2-ethylhexyl)phenyl]benzene |
|---|---|
| PubChem CID | 131637875 |
| Molecular Formula | C90H126 |
| Molecular Weight | 1208.00 g/mol |
| Exact Mass | 1206.99 |
| IUPAC Name | 1,2,3,4,5,6-hexakis[4-(2-ethylhexyl)phenyl]benzene |
| SMILES | CCCCC(CC)Cc1ccc(-c2c(-c3ccc(CC(CC)CCCC)cc3)c(-c3ccc(CC(CC)CCCC)cc3)c(-c3ccc(CC(CC)CCCC)cc3)c(-c3ccc(CC(CC)CCCC)cc3)c2-c2ccc(CC(CC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C90H126/c1-13-25-31-67(19-7)61-73-37-49-79(50-38-73)85-86(80-51-39-74(40-52-80)62-68(20-8)32-26-14-2)88(82-55-43-76(44-56-82)64-70(22-10)34-28-16-4)90(84-59-47-78(48-60-84)66-72(24-12)36-30-18-6)89(83-57-45-77(46-58-83)65-71(23-11)35-29-17-5)87(85)81-53-41-75(42-54-81)63-69(21-9)33-27-15-3/h37-60,67-72H,13-36,61-66H2,1-12H3 |
| InChIKey | JWDUFQTZQJAPJL-UHFFFAOYSA-N |
| XLogP | 28.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 42 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1208.00 |
| LogP ≤ 5 | 28.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |