About 4-(2-butylheptyl)phenol
4-(2-butylheptyl)phenol (PubChem CID 118370129) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-(2-butylheptyl)phenol.
Molecular Properties
| Compound Name | 4-(2-butylheptyl)phenol |
| PubChem CID | 118370129 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 4-(2-butylheptyl)phenol |
| SMILES | CCCCCC(CCCC)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C17H28O/c1-3-5-7-9-15(8-6-4-2)14-16-10-12-17(18)13-11-16/h10-13,15,18H,3-9,14H2,1-2H3 |
| InChIKey | WYYIIUHMUVYBCQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-butylheptyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-butylheptyl)phenol?
The IUPAC name of 4-(2-butylheptyl)phenol (CID 118370129) is 4-(2-butylheptyl)phenol.
What is the SMILES notation for 4-(2-butylheptyl)phenol?
The canonical SMILES for 4-(2-butylheptyl)phenol is CCCCCC(CCCC)Cc1ccc(O)cc1.
What is the InChIKey of 4-(2-butylheptyl)phenol?
The InChIKey is WYYIIUHMUVYBCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O/c1-3-5-7-9-15(8-6-4-2)14-16-10-12-17(18)13-11-16/h10-13,15,18H,3-9,14H2,1-2H3.
What are the key properties of 4-(2-butylheptyl)phenol?
4-(2-butylheptyl)phenol has a molecular weight of 248.41 g/mol, XLogP of 5.32, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-butylheptyl)phenol is sourced from PubChem (CID 118370129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).