C22H39N — CID 68751283
4-(2-hexyldecyl)aniline (PubChem CID 68751283) has the molecular formula C22H39N and a molecular weight of 317.56 g/mol. Its IUPAC name is 4-(2-hexyldecyl)aniline.
| Compound Name | 4-(2-hexyldecyl)aniline |
|---|---|
| PubChem CID | 68751283 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | 4-(2-hexyldecyl)aniline |
| SMILES | CCCCCCCCC(CCCCCC)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C22H39N/c1-3-5-7-9-10-12-14-20(13-11-8-6-4-2)19-21-15-17-22(23)18-16-21/h15-18,20H,3-14,19,23H2,1-2H3 |
| InChIKey | RPNDVNFIVZPZHH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|