C35H42N2 — CID 22920141
4-[1-[4-[2-[[4-[1-(4-aminophenyl)ethyl]phenyl]methyl]hexyl]phenyl]ethyl]aniline (PubChem CID 22920141) has the molecular formula C35H42N2 and a molecular weight of 490.74 g/mol. Its IUPAC name is 4-[1-[4-[2-[[4-[1-(4-aminophenyl)ethyl]phenyl]methyl]hexyl]phenyl]ethyl]aniline.
| Compound Name | 4-[1-[4-[2-[[4-[1-(4-aminophenyl)ethyl]phenyl]methyl]hexyl]phenyl]ethyl]aniline |
|---|---|
| PubChem CID | 22920141 |
| Molecular Formula | C35H42N2 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 4-[1-[4-[2-[[4-[1-(4-aminophenyl)ethyl]phenyl]methyl]hexyl]phenyl]ethyl]aniline |
| SMILES | CCCCC(Cc1ccc(C(C)c2ccc(N)cc2)cc1)Cc1ccc(C(C)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C35H42N2/c1-4-5-6-29(23-27-7-11-30(12-8-27)25(2)32-15-19-34(36)20-16-32)24-28-9-13-31(14-10-28)26(3)33-17-21-35(37)22-18-33/h7-22,25-26,29H,4-6,23-24,36-37H2,1-3H3 |
| InChIKey | KRGOLZURASJINW-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|