C33H44O — CID 118152964
5-[4-[2-ethyl-4-[4-(2-ethylhexyl)phenyl]phenyl]phenyl]pentan-1-ol (PubChem CID 118152964) has the molecular formula C33H44O and a molecular weight of 456.71 g/mol. Its IUPAC name is 5-[4-[2-ethyl-4-[4-(2-ethylhexyl)phenyl]phenyl]phenyl]pentan-1-ol.
| Compound Name | 5-[4-[2-ethyl-4-[4-(2-ethylhexyl)phenyl]phenyl]phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 118152964 |
| Molecular Formula | C33H44O |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | 5-[4-[2-ethyl-4-[4-(2-ethylhexyl)phenyl]phenyl]phenyl]pentan-1-ol |
| SMILES | CCCCC(CC)Cc1ccc(-c2ccc(-c3ccc(CCCCCO)cc3)c(CC)c2)cc1 |
| InChI | InChI=1S/C33H44O/c1-4-7-11-26(5-2)24-28-15-17-30(18-16-28)32-21-22-33(29(6-3)25-32)31-19-13-27(14-20-31)12-9-8-10-23-34/h13-22,25-26,34H,4-12,23-24H2,1-3H3 |
| InChIKey | HYAQSDXXOUYEHU-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|