C14H20F2Ti — CID 174433926
1-(2-ethylhexyl)-2,4-difluorobenzene;titanium (PubChem CID 174433926) has the molecular formula C14H20F2Ti and a molecular weight of 274.18 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-2,4-difluorobenzene;titanium.
| Compound Name | 1-(2-ethylhexyl)-2,4-difluorobenzene;titanium |
|---|---|
| PubChem CID | 174433926 |
| Molecular Formula | C14H20F2Ti |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2-ethylhexyl)-2,4-difluorobenzene;titanium |
| SMILES | CCCCC(CC)Cc1ccc(F)cc1F.[Ti] |
| InChI | InChI=1S/C14H20F2.Ti/c1-3-5-6-11(4-2)9-12-7-8-13(15)10-14(12)16;/h7-8,10-11H,3-6,9H2,1-2H3; |
| InChIKey | XEURGBUYSOHPSO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |