C16H22F2O — CID 64558686
1-(2,4-difluorophenyl)-4-ethyloctan-2-one (PubChem CID 64558686) has the molecular formula C16H22F2O and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-4-ethyloctan-2-one.
| Compound Name | 1-(2,4-difluorophenyl)-4-ethyloctan-2-one |
|---|---|
| PubChem CID | 64558686 |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)-4-ethyloctan-2-one |
| SMILES | CCCCC(CC)CC(=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C16H22F2O/c1-3-5-6-12(4-2)9-15(19)10-13-7-8-14(17)11-16(13)18/h7-8,11-12H,3-6,9-10H2,1-2H3 |
| InChIKey | PXQVHCINWZGRFP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |