C23H37F2NO — CID 91717598
N,N-bis(2-ethylhexyl)-2,4-difluorobenzamide (PubChem CID 91717598) has the molecular formula C23H37F2NO and a molecular weight of 381.55 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-2,4-difluorobenzamide.
| Compound Name | N,N-bis(2-ethylhexyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 91717598 |
| Molecular Formula | C23H37F2NO |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-2,4-difluorobenzamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H37F2NO/c1-5-9-11-18(7-3)16-26(17-19(8-4)12-10-6-2)23(27)21-14-13-20(24)15-22(21)25/h13-15,18-19H,5-12,16-17H2,1-4H3 |
| InChIKey | DCATWGDKIKSJCY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |