C18H15F4NO2 — CID 91717088
N-butyl-N-(2,4-difluorobenzoyl)-2,4-difluorobenzamide (PubChem CID 91717088) has the molecular formula C18H15F4NO2 and a molecular weight of 353.31 g/mol. Its IUPAC name is N-butyl-N-(2,4-difluorobenzoyl)-2,4-difluorobenzamide.
| Compound Name | N-butyl-N-(2,4-difluorobenzoyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 91717088 |
| Molecular Formula | C18H15F4NO2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-butyl-N-(2,4-difluorobenzoyl)-2,4-difluorobenzamide |
| SMILES | CCCCN(C(=O)c1ccc(F)cc1F)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H15F4NO2/c1-2-3-8-23(17(24)13-6-4-11(19)9-15(13)21)18(25)14-7-5-12(20)10-16(14)22/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | CVWKEHUNKYAXBF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|