C17H17F2NOTi — CID 174382924
N-butyl-N-(2,4-difluorophenyl)benzamide;titanium (PubChem CID 174382924) has the molecular formula C17H17F2NOTi and a molecular weight of 337.19 g/mol. Its IUPAC name is N-butyl-N-(2,4-difluorophenyl)benzamide;titanium.
| Compound Name | N-butyl-N-(2,4-difluorophenyl)benzamide;titanium |
|---|---|
| PubChem CID | 174382924 |
| Molecular Formula | C17H17F2NOTi |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-butyl-N-(2,4-difluorophenyl)benzamide;titanium |
| SMILES | CCCCN(C(=O)c1ccccc1)c1ccc(F)cc1F.[Ti] |
| InChI | InChI=1S/C17H17F2NO.Ti/c1-2-3-11-20(16-10-9-14(18)12-15(16)19)17(21)13-7-5-4-6-8-13;/h4-10,12H,2-3,11H2,1H3; |
| InChIKey | XVXCZHINFYRKDY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |