C17H25F2NO2 — CID 71580940
N-(2,4-difluorophenyl)-N-(6-hydroxyhexyl)-2,2-dimethylpropanamide (PubChem CID 71580940) has the molecular formula C17H25F2NO2 and a molecular weight of 313.39 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-(6-hydroxyhexyl)-2,2-dimethylpropanamide.
| Compound Name | N-(2,4-difluorophenyl)-N-(6-hydroxyhexyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 71580940 |
| Molecular Formula | C17H25F2NO2 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-(6-hydroxyhexyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N(CCCCCCO)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H25F2NO2/c1-17(2,3)16(22)20(10-6-4-5-7-11-21)15-9-8-13(18)12-14(15)19/h8-9,12,21H,4-7,10-11H2,1-3H3 |
| InChIKey | FZWYYDCNGPJVGS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|