C15H20F2NOTi- — CID 174383944
N-butyl-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium (PubChem CID 174383944) has the molecular formula C15H20F2NOTi- and a molecular weight of 316.19 g/mol. Its IUPAC name is N-butyl-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium.
| Compound Name | N-butyl-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium |
|---|---|
| PubChem CID | 174383944 |
| Molecular Formula | C15H20F2NOTi- |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-butyl-N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpropanamide;titanium |
| SMILES | CCCCN(C(=O)C(C)(C)C)c1ccc(F)[c-]c1F.[Ti] |
| InChI | InChI=1S/C15H20F2NO.Ti/c1-5-6-9-18(14(19)15(2,3)4)13-8-7-11(16)10-12(13)17;/h7-8H,5-6,9H2,1-4H3;/q-1; |
| InChIKey | PERYDOBBPATAOF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|