C21H15ClF2NOTi- — CID 174393948
2-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-N-[(4-methylphenyl)methyl]benzamide;titanium (PubChem CID 174393948) has the molecular formula C21H15ClF2NOTi- and a molecular weight of 418.67 g/mol. Its IUPAC name is 2-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-N-[(4-methylphenyl)methyl]benzamide;titanium.
| Compound Name | 2-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-N-[(4-methylphenyl)methyl]benzamide;titanium |
|---|---|
| PubChem CID | 174393948 |
| Molecular Formula | C21H15ClF2NOTi- |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 2-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-N-[(4-methylphenyl)methyl]benzamide;titanium |
| SMILES | Cc1ccc(CN(C(=O)c2ccccc2Cl)c2ccc(F)[c-]c2F)cc1.[Ti] |
| InChI | InChI=1S/C21H15ClF2NO.Ti/c1-14-6-8-15(9-7-14)13-25(20-11-10-16(23)12-19(20)24)21(26)17-4-2-3-5-18(17)22;/h2-11H,13H2,1H3;/q-1; |
| InChIKey | HOLXITWJOXOLRL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|