C10H9F2NO3 — CID 28766218
2-(N-acetyl-2,4-difluoroanilino)acetic acid (PubChem CID 28766218) has the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. Its IUPAC name is 2-(N-acetyl-2,4-difluoroanilino)acetic acid.
| Compound Name | 2-(N-acetyl-2,4-difluoroanilino)acetic acid |
|---|---|
| PubChem CID | 28766218 |
| Molecular Formula | C10H9F2NO3 |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-(N-acetyl-2,4-difluoroanilino)acetic acid |
| SMILES | CC(=O)N(CC(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2NO3/c1-6(14)13(5-10(15)16)9-3-2-7(11)4-8(9)12/h2-4H,5H2,1H3,(H,15,16) |
| InChIKey | WDPGJXORZJWYBF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |