C14H18F2N2O2 — CID 113178927
2-(N-acetyl-2,4-difluoroanilino)-N-butan-2-ylacetamide (PubChem CID 113178927) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-(N-acetyl-2,4-difluoroanilino)-N-butan-2-ylacetamide.
| Compound Name | 2-(N-acetyl-2,4-difluoroanilino)-N-butan-2-ylacetamide |
|---|---|
| PubChem CID | 113178927 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(N-acetyl-2,4-difluoroanilino)-N-butan-2-ylacetamide |
| SMILES | CCC(C)NC(=O)CN(C(C)=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H18F2N2O2/c1-4-9(2)17-14(20)8-18(10(3)19)13-6-5-11(15)7-12(13)16/h5-7,9H,4,8H2,1-3H3,(H,17,20) |
| InChIKey | KKFUGYHNWIKRSO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |