C15H20F2N2O3 — CID 113063345
tert-butyl N-[2-(N-acetyl-2,4-difluoroanilino)ethyl]carbamate (PubChem CID 113063345) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is tert-butyl N-[2-(N-acetyl-2,4-difluoroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(N-acetyl-2,4-difluoroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113063345 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | tert-butyl N-[2-(N-acetyl-2,4-difluoroanilino)ethyl]carbamate |
| SMILES | CC(=O)N(CCNC(=O)OC(C)(C)C)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F2N2O3/c1-10(20)19(13-6-5-11(16)9-12(13)17)8-7-18-14(21)22-15(2,3)4/h5-6,9H,7-8H2,1-4H3,(H,18,21) |
| InChIKey | UUEOAPHFSHALTD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |