C18H19F2NO2 — CID 71458389
4-butoxy-N-(2,4-difluorophenyl)-N-methylbenzamide (PubChem CID 71458389) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is 4-butoxy-N-(2,4-difluorophenyl)-N-methylbenzamide.
| Compound Name | 4-butoxy-N-(2,4-difluorophenyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 71458389 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-butoxy-N-(2,4-difluorophenyl)-N-methylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(C)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H19F2NO2/c1-3-4-11-23-15-8-5-13(6-9-15)18(22)21(2)17-10-7-14(19)12-16(17)20/h5-10,12H,3-4,11H2,1-2H3 |
| InChIKey | MPUVVVBGFUWZAP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|