C9H9F2NO2 — CID 67276002
methyl N-(2,4-difluorophenyl)-N-methylcarbamate (PubChem CID 67276002) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is methyl N-(2,4-difluorophenyl)-N-methylcarbamate.
| Compound Name | methyl N-(2,4-difluorophenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 67276002 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | methyl N-(2,4-difluorophenyl)-N-methylcarbamate |
| SMILES | COC(=O)N(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H9F2NO2/c1-12(9(13)14-2)8-4-3-6(10)5-7(8)11/h3-5H,1-2H3 |
| InChIKey | RFKCMLSZUIQZDP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |