C13H13F2N3O — CID 3611810
2-cyano-N-(2,4-difluorophenyl)-3-(dimethylamino)-N-methylprop-2-enamide (PubChem CID 3611810) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-cyano-N-(2,4-difluorophenyl)-3-(dimethylamino)-N-methylprop-2-enamide.
| Compound Name | 2-cyano-N-(2,4-difluorophenyl)-3-(dimethylamino)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 3611810 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-cyano-N-(2,4-difluorophenyl)-3-(dimethylamino)-N-methylprop-2-enamide |
| SMILES | CN(C)C=C(C#N)C(=O)N(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H13F2N3O/c1-17(2)8-9(7-16)13(19)18(3)12-5-4-10(14)6-11(12)15/h4-6,8H,1-3H3 |
| InChIKey | ZKLKRGMYRUXSKB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|