C13H14F2N2O — CID 115188569
2-cyano-N-(2,4-difluorophenyl)-N,3-dimethylbutanamide (PubChem CID 115188569) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-cyano-N-(2,4-difluorophenyl)-N,3-dimethylbutanamide.
| Compound Name | 2-cyano-N-(2,4-difluorophenyl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115188569 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-cyano-N-(2,4-difluorophenyl)-N,3-dimethylbutanamide |
| SMILES | CC(C)C(C#N)C(=O)N(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2N2O/c1-8(2)10(7-16)13(18)17(3)12-5-4-9(14)6-11(12)15/h4-6,8,10H,1-3H3 |
| InChIKey | UMSVUHCGRSCRGF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |