C14H18N2O2 — CID 62002443
2-cyano-N-(3-methoxyphenyl)-N,3-dimethylbutanamide (PubChem CID 62002443) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-cyano-N-(3-methoxyphenyl)-N,3-dimethylbutanamide.
| Compound Name | 2-cyano-N-(3-methoxyphenyl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 62002443 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-cyano-N-(3-methoxyphenyl)-N,3-dimethylbutanamide |
| SMILES | COc1cccc(N(C)C(=O)C(C#N)C(C)C)c1 |
| InChI | InChI=1S/C14H18N2O2/c1-10(2)13(9-15)14(17)16(3)11-6-5-7-12(8-11)18-4/h5-8,10,13H,1-4H3 |
| InChIKey | XKEWCLJPNVNAKZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |