C14H17FN2O — CID 115188553
2-cyano-N-(4-fluoro-3-methylphenyl)-N,3-dimethylbutanamide (PubChem CID 115188553) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-cyano-N-(4-fluoro-3-methylphenyl)-N,3-dimethylbutanamide.
| Compound Name | 2-cyano-N-(4-fluoro-3-methylphenyl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115188553 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-cyano-N-(4-fluoro-3-methylphenyl)-N,3-dimethylbutanamide |
| SMILES | Cc1cc(N(C)C(=O)C(C#N)C(C)C)ccc1F |
| InChI | InChI=1S/C14H17FN2O/c1-9(2)12(8-16)14(18)17(4)11-5-6-13(15)10(3)7-11/h5-7,9,12H,1-4H3 |
| InChIKey | BTHKEPQDEYHDSS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |