C13H16FNO3 — CID 115174602
methyl 4-(4-fluoro-N,3-dimethylanilino)-4-oxobutanoate (PubChem CID 115174602) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is methyl 4-(4-fluoro-N,3-dimethylanilino)-4-oxobutanoate.
| Compound Name | methyl 4-(4-fluoro-N,3-dimethylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 115174602 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 4-(4-fluoro-N,3-dimethylanilino)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N(C)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C13H16FNO3/c1-9-8-10(4-5-11(9)14)15(2)12(16)6-7-13(17)18-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | COONWZFILSPEHI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |