C12H15FN2O3 — CID 115181260
3-amino-4-(4-fluoro-N,3-dimethylanilino)-4-oxobutanoic acid (PubChem CID 115181260) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is 3-amino-4-(4-fluoro-N,3-dimethylanilino)-4-oxobutanoic acid.
| Compound Name | 3-amino-4-(4-fluoro-N,3-dimethylanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 115181260 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-amino-4-(4-fluoro-N,3-dimethylanilino)-4-oxobutanoic acid |
| SMILES | Cc1cc(N(C)C(=O)C(N)CC(=O)O)ccc1F |
| InChI | InChI=1S/C12H15FN2O3/c1-7-5-8(3-4-9(7)13)15(2)12(18)10(14)6-11(16)17/h3-5,10H,6,14H2,1-2H3,(H,16,17) |
| InChIKey | ANZRBNHNSXMCNS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |