C19H20FNO3 — CID 167089437
methyl 3-(N-(2,6-dimethylphenyl)-4-fluoro-3-methylanilino)-3-oxopropanoate (PubChem CID 167089437) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is methyl 3-(N-(2,6-dimethylphenyl)-4-fluoro-3-methylanilino)-3-oxopropanoate.
| Compound Name | methyl 3-(N-(2,6-dimethylphenyl)-4-fluoro-3-methylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 167089437 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl 3-(N-(2,6-dimethylphenyl)-4-fluoro-3-methylanilino)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)N(c1ccc(F)c(C)c1)c1c(C)cccc1C |
| InChI | InChI=1S/C19H20FNO3/c1-12-6-5-7-13(2)19(12)21(17(22)11-18(23)24-4)15-8-9-16(20)14(3)10-15/h5-10H,11H2,1-4H3 |
| InChIKey | YQNXOANIFSIIAB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|