C18H17BrFNO3 — CID 167089429
methyl 3-(3-bromo-N-(2,6-dimethylphenyl)-4-fluoroanilino)-3-oxopropanoate (PubChem CID 167089429) has the molecular formula C18H17BrFNO3 and a molecular weight of 394.24 g/mol. Its IUPAC name is methyl 3-(3-bromo-N-(2,6-dimethylphenyl)-4-fluoroanilino)-3-oxopropanoate.
| Compound Name | methyl 3-(3-bromo-N-(2,6-dimethylphenyl)-4-fluoroanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 167089429 |
| Molecular Formula | C18H17BrFNO3 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | methyl 3-(3-bromo-N-(2,6-dimethylphenyl)-4-fluoroanilino)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)N(c1ccc(F)c(Br)c1)c1c(C)cccc1C |
| InChI | InChI=1S/C18H17BrFNO3/c1-11-5-4-6-12(2)18(11)21(16(22)10-17(23)24-3)13-7-8-15(20)14(19)9-13/h4-9H,10H2,1-3H3 |
| InChIKey | OYAARIBKVDQCFY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|